C31H50O4 — CID 101276928
[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]spiro[1,2,3,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-6,2'-1,3-dioxolane]-3-yl] acetate (PubChem CID 101276928) has the molecular formula C31H50O4 and a molecular weight of 486.74 g/mol. Its IUPAC name is [(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]spiro[1,2,3,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-6,2'-1,3-dioxolane]-3-yl] acetate.
| Compound Name | [(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]spiro[1,2,3,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-6,2'-1,3-dioxolane]-3-yl] acetate |
|---|---|
| PubChem CID | 101276928 |
| Molecular Formula | C31H50O4 |
| Molecular Weight | 486.74 g/mol |
| Exact Mass | 486.37 |
| IUPAC Name | [(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]spiro[1,2,3,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-6,2'-1,3-dioxolane]-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C=C2C3(C[C@H]4[C@@H]5CC[C@H]([C@H](C)CCCC(C)C)[C@@]5(C)CC[C@@H]4[C@@]2(C)CC1)OCCO3 |
| InChI | InChI=1S/C31H50O4/c1-20(2)8-7-9-21(3)25-10-11-26-24-19-31(33-16-17-34-31)28-18-23(35-22(4)32)12-14-30(28,6)27(24)13-15-29(25,26)5/h18,20-21,23-27H,7-17,19H2,1-6H3/t21-,23+,24+,25-,26+,27+,29-,30-/m1/s1 |
| InChIKey | NMOAPMTWMVTOEB-RQJKZTJDSA-N |
| XLogP | 7.31 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.74 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|