C32H54O3 — CID 101278594
[(4R,4aS,6aS,6aS,6bR,8aR,12aR,14aS,14bR)-6-hydroxy-4,4a,6a,6b,8a,11,11,14a-octamethyl-1,2,3,4,5,6,6a,7,8,9,10,12,12a,13,14,14b-hexadecahydropicen-3-yl] acetate (PubChem CID 101278594) has the molecular formula C32H54O3 and a molecular weight of 486.78 g/mol. Its IUPAC name is [(4R,4aS,6aS,6aS,6bR,8aR,12aR,14aS,14bR)-6-hydroxy-4,4a,6a,6b,8a,11,11,14a-octamethyl-1,2,3,4,5,6,6a,7,8,9,10,12,12a,13,14,14b-hexadecahydropicen-3-yl] acetate.
| Compound Name | [(4R,4aS,6aS,6aS,6bR,8aR,12aR,14aS,14bR)-6-hydroxy-4,4a,6a,6b,8a,11,11,14a-octamethyl-1,2,3,4,5,6,6a,7,8,9,10,12,12a,13,14,14b-hexadecahydropicen-3-yl] acetate |
|---|---|
| PubChem CID | 101278594 |
| Molecular Formula | C32H54O3 |
| Molecular Weight | 486.78 g/mol |
| Exact Mass | 486.41 |
| IUPAC Name | [(4R,4aS,6aS,6aS,6bR,8aR,12aR,14aS,14bR)-6-hydroxy-4,4a,6a,6b,8a,11,11,14a-octamethyl-1,2,3,4,5,6,6a,7,8,9,10,12,12a,13,14,14b-hexadecahydropicen-3-yl] acetate |
| SMILES | CC(=O)OC1CC[C@@H]2[C@](C)(CC(O)[C@H]3[C@@]2(C)CC[C@@]2(C)[C@@H]4CC(C)(C)CC[C@]4(C)CC[C@]32C)[C@H]1C |
| InChI | InChI=1S/C32H54O3/c1-20-23(35-21(2)33)10-11-24-29(6)15-17-31(8)25-19-27(3,4)12-13-28(25,5)14-16-32(31,9)26(29)22(34)18-30(20,24)7/h20,22-26,34H,10-19H2,1-9H3/t20-,22?,23?,24-,25+,26-,28+,29-,30+,31-,32+/m0/s1 |
| InChIKey | QZVCQWDEBQXSKT-RAHJORBPSA-N |
| XLogP | 7.79 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.78 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |