C31H54O — CID 163025213
(4,4a,6a,6b,8a,11,11,14a-octamethyl-1,2,3,4,5,6,6a,7,8,9,10,12,12a,13,14,14b-hexadecahydropicen-3-yl)methanol (PubChem CID 163025213) has the molecular formula C31H54O and a molecular weight of 442.77 g/mol. Its IUPAC name is (4,4a,6a,6b,8a,11,11,14a-octamethyl-1,2,3,4,5,6,6a,7,8,9,10,12,12a,13,14,14b-hexadecahydropicen-3-yl)methanol.
| Compound Name | (4,4a,6a,6b,8a,11,11,14a-octamethyl-1,2,3,4,5,6,6a,7,8,9,10,12,12a,13,14,14b-hexadecahydropicen-3-yl)methanol |
|---|---|
| PubChem CID | 163025213 |
| Molecular Formula | C31H54O |
| Molecular Weight | 442.77 g/mol |
| Exact Mass | 442.42 |
| IUPAC Name | (4,4a,6a,6b,8a,11,11,14a-octamethyl-1,2,3,4,5,6,6a,7,8,9,10,12,12a,13,14,14b-hexadecahydropicen-3-yl)methanol |
| SMILES | CC1C(CO)CCC2C1(C)CCC1C2(C)CCC2(C)C3CC(C)(C)CCC3(C)CCC12C |
| InChI | InChI=1S/C31H54O/c1-21-22(20-32)9-10-23-28(21,5)12-11-24-29(23,6)16-18-31(8)25-19-26(2,3)13-14-27(25,4)15-17-30(24,31)7/h21-25,32H,9-20H2,1-8H3 |
| InChIKey | IOULPINTLZIDLM-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.77 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |