C30H52O2 — CID 162864160
1-(3-hydroxypropyl)-4b,6a,9,9,10b,12a-hexamethyl-2-prop-1-en-2-yl-1,3,4,4a,5,6,7,8,10,10a,11,12-dodecahydrochrysen-2-ol (PubChem CID 162864160) has the molecular formula C30H52O2 and a molecular weight of 444.74 g/mol. Its IUPAC name is 1-(3-hydroxypropyl)-4b,6a,9,9,10b,12a-hexamethyl-2-prop-1-en-2-yl-1,3,4,4a,5,6,7,8,10,10a,11,12-dodecahydrochrysen-2-ol.
| Compound Name | 1-(3-hydroxypropyl)-4b,6a,9,9,10b,12a-hexamethyl-2-prop-1-en-2-yl-1,3,4,4a,5,6,7,8,10,10a,11,12-dodecahydrochrysen-2-ol |
|---|---|
| PubChem CID | 162864160 |
| Molecular Formula | C30H52O2 |
| Molecular Weight | 444.74 g/mol |
| Exact Mass | 444.40 |
| IUPAC Name | 1-(3-hydroxypropyl)-4b,6a,9,9,10b,12a-hexamethyl-2-prop-1-en-2-yl-1,3,4,4a,5,6,7,8,10,10a,11,12-dodecahydrochrysen-2-ol |
| SMILES | C=C(C)C1(O)CCC2C(C)(CCC3(C)C4CC(C)(C)CCC4(C)CCC23C)C1CCCO |
| InChI | InChI=1S/C30H52O2/c1-21(2)30(32)12-11-22-27(6,23(30)10-9-19-31)16-18-29(8)24-20-25(3,4)13-14-26(24,5)15-17-28(22,29)7/h22-24,31-32H,1,9-20H2,2-8H3 |
| InChIKey | MWXHPTNZHHMATE-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.74 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|