C32H54O4 — CID 565450
methyl 2-[1-(2-methoxy-2-oxoethyl)-2,4b,6a,9,9,10b,12a-heptamethyl-1,3,4,4a,5,6,7,8,10,10a,11,12-dodecahydrochrysen-2-yl]propanoate (PubChem CID 565450) has the molecular formula C32H54O4 and a molecular weight of 502.78 g/mol. Its IUPAC name is methyl 2-[1-(2-methoxy-2-oxoethyl)-2,4b,6a,9,9,10b,12a-heptamethyl-1,3,4,4a,5,6,7,8,10,10a,11,12-dodecahydrochrysen-2-yl]propanoate.
| Compound Name | methyl 2-[1-(2-methoxy-2-oxoethyl)-2,4b,6a,9,9,10b,12a-heptamethyl-1,3,4,4a,5,6,7,8,10,10a,11,12-dodecahydrochrysen-2-yl]propanoate |
|---|---|
| PubChem CID | 565450 |
| Molecular Formula | C32H54O4 |
| Molecular Weight | 502.78 g/mol |
| Exact Mass | 502.40 |
| IUPAC Name | methyl 2-[1-(2-methoxy-2-oxoethyl)-2,4b,6a,9,9,10b,12a-heptamethyl-1,3,4,4a,5,6,7,8,10,10a,11,12-dodecahydrochrysen-2-yl]propanoate |
| SMILES | COC(=O)CC1C(C)(C(C)C(=O)OC)CCC2C1(C)CCC1(C)C3CC(C)(C)CCC3(C)CCC21C |
| InChI | InChI=1S/C32H54O4/c1-21(26(34)36-10)29(5)12-11-22-30(6,23(29)19-25(33)35-9)16-18-32(8)24-20-27(2,3)13-14-28(24,4)15-17-31(22,32)7/h21-24H,11-20H2,1-10H3 |
| InChIKey | CYTUCTBTICNVAN-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.78 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |