C30H46O4 — CID 592046
4,6a,6b,8a,11,11,14a-heptamethyl-1,3-dioxo-5,6,6a,7,8,9,10,12,12a,13,14,14b-dodecahydro-4H-picene-4a-carboxylic acid (PubChem CID 592046) has the molecular formula C30H46O4 and a molecular weight of 470.69 g/mol. Its IUPAC name is 4,6a,6b,8a,11,11,14a-heptamethyl-1,3-dioxo-5,6,6a,7,8,9,10,12,12a,13,14,14b-dodecahydro-4H-picene-4a-carboxylic acid.
| Compound Name | 4,6a,6b,8a,11,11,14a-heptamethyl-1,3-dioxo-5,6,6a,7,8,9,10,12,12a,13,14,14b-dodecahydro-4H-picene-4a-carboxylic acid |
|---|---|
| PubChem CID | 592046 |
| Molecular Formula | C30H46O4 |
| Molecular Weight | 470.69 g/mol |
| Exact Mass | 470.34 |
| IUPAC Name | 4,6a,6b,8a,11,11,14a-heptamethyl-1,3-dioxo-5,6,6a,7,8,9,10,12,12a,13,14,14b-dodecahydro-4H-picene-4a-carboxylic acid |
| SMILES | CC1C(=O)CC(=O)C2C3(C)CCC4(C)C5CC(C)(C)CCC5(C)CCC4(C)C3CCC12C(=O)O |
| InChI | InChI=1S/C30H46O4/c1-18-19(31)16-20(32)23-27(5)13-15-29(7)22-17-25(2,3)10-11-26(22,4)12-14-28(29,6)21(27)8-9-30(18,23)24(33)34/h18,21-23H,8-17H2,1-7H3,(H,33,34) |
| InChIKey | QJGPWTXKQGCKCJ-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.69 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|