C31H48O3 — CID 24867646
(4S,5R,10R,17R,18R,23R)-4,7,7,10,17,18,23-heptamethyl-24-oxahexacyclo[11.9.3.01,14.04,13.05,10.017,22]pentacosane-19,21-dione (PubChem CID 24867646) has the molecular formula C31H48O3 and a molecular weight of 468.72 g/mol. Its IUPAC name is (4S,5R,10R,17R,18R,23R)-4,7,7,10,17,18,23-heptamethyl-24-oxahexacyclo[11.9.3.01,14.04,13.05,10.017,22]pentacosane-19,21-dione.
| Compound Name | (4S,5R,10R,17R,18R,23R)-4,7,7,10,17,18,23-heptamethyl-24-oxahexacyclo[11.9.3.01,14.04,13.05,10.017,22]pentacosane-19,21-dione |
|---|---|
| PubChem CID | 24867646 |
| Molecular Formula | C31H48O3 |
| Molecular Weight | 468.72 g/mol |
| Exact Mass | 468.36 |
| IUPAC Name | (4S,5R,10R,17R,18R,23R)-4,7,7,10,17,18,23-heptamethyl-24-oxahexacyclo[11.9.3.01,14.04,13.05,10.017,22]pentacosane-19,21-dione |
| SMILES | C[C@H]1OCC23CC[C@@]4(C)CCC(C)(C)C[C@H]4[C@]2(C)CCC12C3CC[C@@]1(C)C2C(=O)CC(=O)[C@@H]1C |
| InChI | InChI=1S/C31H48O3/c1-19-21(32)16-22(33)25-28(19,6)9-8-23-30-14-12-27(5)11-10-26(3,4)17-24(27)29(30,7)13-15-31(23,25)20(2)34-18-30/h19-20,23-25H,8-18H2,1-7H3/t19-,20+,23?,24+,25?,27+,28+,29-,30?,31?/m0/s1 |
| InChIKey | NSWGAYVQHYDGCO-XQYSICCKSA-N |
| XLogP | 7.01 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.72 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|