C30H46O3 — CID 163117305
(1S,4S,5S,10R,13S,14R,17R,18R,22S)-19-hydroxy-4,7,7,10,17,18-hexamethyl-24-oxahexacyclo[11.9.3.01,14.04,13.05,10.017,22]pentacos-19-en-21-one (PubChem CID 163117305) has the molecular formula C30H46O3 and a molecular weight of 454.70 g/mol. Its IUPAC name is (1S,4S,5S,10R,13S,14R,17R,18R,22S)-19-hydroxy-4,7,7,10,17,18-hexamethyl-24-oxahexacyclo[11.9.3.01,14.04,13.05,10.017,22]pentacos-19-en-21-one.
| Compound Name | (1S,4S,5S,10R,13S,14R,17R,18R,22S)-19-hydroxy-4,7,7,10,17,18-hexamethyl-24-oxahexacyclo[11.9.3.01,14.04,13.05,10.017,22]pentacos-19-en-21-one |
|---|---|
| PubChem CID | 163117305 |
| Molecular Formula | C30H46O3 |
| Molecular Weight | 454.70 g/mol |
| Exact Mass | 454.34 |
| IUPAC Name | (1S,4S,5S,10R,13S,14R,17R,18R,22S)-19-hydroxy-4,7,7,10,17,18-hexamethyl-24-oxahexacyclo[11.9.3.01,14.04,13.05,10.017,22]pentacos-19-en-21-one |
| SMILES | C[C@H]1C(O)=CC(=O)[C@H]2[C@]1(C)CC[C@@H]1[C@@]23CC[C@@]2(C)[C@H]4CC(C)(C)CC[C@]4(C)CC[C@]12COC3 |
| InChI | InChI=1S/C30H46O3/c1-19-20(31)15-21(32)24-27(19,5)8-7-22-29(24)13-12-28(6)23-16-25(2,3)9-10-26(23,4)11-14-30(22,28)18-33-17-29/h15,19,22-24,31H,7-14,16-18H2,1-6H3/t19-,22+,23-,24-,26+,27+,28-,29-,30-/m0/s1 |
| InChIKey | AGUOXLGCGOKFIQ-FGWUINCDSA-N |
| XLogP | 7.11 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.70 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |