C30H48O2 — CID 101286919
(1S,4S,5R,10R,13R,14S,17R,18S,22R)-4,7,7,10,17,18-hexamethyl-24-oxahexacyclo[11.9.3.01,14.04,13.05,10.017,22]pentacosan-21-one (PubChem CID 101286919) has the molecular formula C30H48O2 and a molecular weight of 440.71 g/mol. Its IUPAC name is (1S,4S,5R,10R,13R,14S,17R,18S,22R)-4,7,7,10,17,18-hexamethyl-24-oxahexacyclo[11.9.3.01,14.04,13.05,10.017,22]pentacosan-21-one.
| Compound Name | (1S,4S,5R,10R,13R,14S,17R,18S,22R)-4,7,7,10,17,18-hexamethyl-24-oxahexacyclo[11.9.3.01,14.04,13.05,10.017,22]pentacosan-21-one |
|---|---|
| PubChem CID | 101286919 |
| Molecular Formula | C30H48O2 |
| Molecular Weight | 440.71 g/mol |
| Exact Mass | 440.37 |
| IUPAC Name | (1S,4S,5R,10R,13R,14S,17R,18S,22R)-4,7,7,10,17,18-hexamethyl-24-oxahexacyclo[11.9.3.01,14.04,13.05,10.017,22]pentacosan-21-one |
| SMILES | C[C@H]1CCC(=O)[C@@H]2[C@]1(C)CC[C@H]1[C@@]23CC[C@@]2(C)[C@@H]4CC(C)(C)CC[C@]4(C)CC[C@@]12COC3 |
| InChI | InChI=1S/C30H48O2/c1-20-7-8-21(31)24-27(20,5)10-9-22-29(24)15-14-28(6)23-17-25(2,3)11-12-26(23,4)13-16-30(22,28)19-32-18-29/h20,22-24H,7-19H2,1-6H3/t20-,22-,23+,24+,26+,27+,28-,29-,30+/m0/s1 |
| InChIKey | NQZAAOGCYSAEBL-ATTXLITFSA-N |
| XLogP | 7.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.71 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |