C28H46O3 — CID 78144390
13b-hydroxy-3,3a,5b,7a,10,10,11b,13a-octamethyl-3,4,5,5a,6,7,8,9,11,11a,12,13-dodecahydrophenanthro[1,2-g][1]benzofuran-2-one (PubChem CID 78144390) has the molecular formula C28H46O3 and a molecular weight of 430.67 g/mol. Its IUPAC name is 13b-hydroxy-3,3a,5b,7a,10,10,11b,13a-octamethyl-3,4,5,5a,6,7,8,9,11,11a,12,13-dodecahydrophenanthro[1,2-g][1]benzofuran-2-one.
| Compound Name | 13b-hydroxy-3,3a,5b,7a,10,10,11b,13a-octamethyl-3,4,5,5a,6,7,8,9,11,11a,12,13-dodecahydrophenanthro[1,2-g][1]benzofuran-2-one |
|---|---|
| PubChem CID | 78144390 |
| Molecular Formula | C28H46O3 |
| Molecular Weight | 430.67 g/mol |
| Exact Mass | 430.34 |
| IUPAC Name | 13b-hydroxy-3,3a,5b,7a,10,10,11b,13a-octamethyl-3,4,5,5a,6,7,8,9,11,11a,12,13-dodecahydrophenanthro[1,2-g][1]benzofuran-2-one |
| SMILES | CC1C(=O)OC2(O)C1(C)CCC1C3(C)CCC4(C)CCC(C)(C)CC4C3(C)CCC12C |
| InChI | InChI=1S/C28H46O3/c1-18-21(29)31-28(30)24(18,5)10-9-19-25(6)14-13-23(4)12-11-22(2,3)17-20(23)26(25,7)15-16-27(19,28)8/h18-20,30H,9-17H2,1-8H3 |
| InChIKey | QCYIATUMOXVKDK-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.67 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |