C30H48O2 — CID 50900325
(4S,4aS,6aS,6aS,6bR,8aR,12aR,14aR,14bS)-4-hydroxy-4,4a,6a,6b,8a,11,11,14a-octamethyl-5,6,6a,7,8,9,10,12,12a,13,14,14b-dodecahydropicen-3-one (PubChem CID 50900325) has the molecular formula C30H48O2 and a molecular weight of 440.71 g/mol. Its IUPAC name is (4S,4aS,6aS,6aS,6bR,8aR,12aR,14aR,14bS)-4-hydroxy-4,4a,6a,6b,8a,11,11,14a-octamethyl-5,6,6a,7,8,9,10,12,12a,13,14,14b-dodecahydropicen-3-one.
| Compound Name | (4S,4aS,6aS,6aS,6bR,8aR,12aR,14aR,14bS)-4-hydroxy-4,4a,6a,6b,8a,11,11,14a-octamethyl-5,6,6a,7,8,9,10,12,12a,13,14,14b-dodecahydropicen-3-one |
|---|---|
| PubChem CID | 50900325 |
| Molecular Formula | C30H48O2 |
| Molecular Weight | 440.71 g/mol |
| Exact Mass | 440.37 |
| IUPAC Name | (4S,4aS,6aS,6aS,6bR,8aR,12aR,14aR,14bS)-4-hydroxy-4,4a,6a,6b,8a,11,11,14a-octamethyl-5,6,6a,7,8,9,10,12,12a,13,14,14b-dodecahydropicen-3-one |
| SMILES | CC1(C)CC[C@]2(C)CC[C@]3(C)[C@H]4CC[C@@]5(C)[C@@H](C=CC(=O)[C@@]5(C)O)[C@]4(C)CC[C@@]3(C)[C@@H]2C1 |
| InChI | InChI=1S/C30H48O2/c1-24(2)13-14-25(3)15-17-27(5)21-11-12-29(7)20(9-10-23(31)30(29,8)32)26(21,4)16-18-28(27,6)22(25)19-24/h9-10,20-22,32H,11-19H2,1-8H3/t20-,21-,22+,25+,26-,27+,28-,29-,30+/m0/s1 |
| InChIKey | HVDFONKTLBTCGS-VAKVGTBTSA-N |
| XLogP | 7.35 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.71 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |