C30H50O — CID 101286920
(1R,4S,5R,10R,13R,14S,17R,18S,22R)-4,7,7,10,17,18-hexamethyl-24-oxahexacyclo[11.9.3.01,14.04,13.05,10.017,22]pentacosane (PubChem CID 101286920) has the molecular formula C30H50O and a molecular weight of 426.73 g/mol. Its IUPAC name is (1R,4S,5R,10R,13R,14S,17R,18S,22R)-4,7,7,10,17,18-hexamethyl-24-oxahexacyclo[11.9.3.01,14.04,13.05,10.017,22]pentacosane.
| Compound Name | (1R,4S,5R,10R,13R,14S,17R,18S,22R)-4,7,7,10,17,18-hexamethyl-24-oxahexacyclo[11.9.3.01,14.04,13.05,10.017,22]pentacosane |
|---|---|
| PubChem CID | 101286920 |
| Molecular Formula | C30H50O |
| Molecular Weight | 426.73 g/mol |
| Exact Mass | 426.39 |
| IUPAC Name | (1R,4S,5R,10R,13R,14S,17R,18S,22R)-4,7,7,10,17,18-hexamethyl-24-oxahexacyclo[11.9.3.01,14.04,13.05,10.017,22]pentacosane |
| SMILES | C[C@H]1CCC[C@@H]2[C@]1(C)CC[C@H]1[C@@]23CC[C@@]2(C)[C@@H]4CC(C)(C)CC[C@]4(C)CC[C@@]12COC3 |
| InChI | InChI=1S/C30H50O/c1-21-8-7-9-22-27(21,5)11-10-23-29(22)16-15-28(6)24-18-25(2,3)12-13-26(24,4)14-17-30(23,28)20-31-19-29/h21-24H,7-20H2,1-6H3/t21-,22+,23-,24+,26+,27+,28-,29+,30+/m0/s1 |
| InChIKey | SKWKHKIRYWZXNO-NKDMJFTISA-N |
| XLogP | 8.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.73 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |