About bis[2-(2-ethoxyethoxy)ethyl] 2-butylpropanedioate
bis[2-(2-ethoxyethoxy)ethyl] 2-butylpropanedioate (PubChem CID 101278843) has the molecular formula C19H36O8
and a molecular weight of 392.49 g/mol. Its IUPAC name is bis[2-(2-ethoxyethoxy)ethyl] 2-butylpropanedioate.
Molecular Properties
| Compound Name | bis[2-(2-ethoxyethoxy)ethyl] 2-butylpropanedioate |
| PubChem CID | 101278843 |
| Molecular Formula | C19H36O8 |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | bis[2-(2-ethoxyethoxy)ethyl] 2-butylpropanedioate |
| SMILES | CCCCC(C(=O)OCCOCCOCC)C(=O)OCCOCCOCC |
| InChI | InChI=1S/C19H36O8/c1-4-7-8-17(18(20)26-15-13-24-11-9-22-5-2)19(21)27-16-14-25-12-10-23-6-3/h17H,4-16H2,1-3H3 |
| InChIKey | CNJSCUQCPBCUMD-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze bis[2-(2-ethoxyethoxy)ethyl] 2-butylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[2-(2-ethoxyethoxy)ethyl] 2-butylpropanedioate?
The IUPAC name of bis[2-(2-ethoxyethoxy)ethyl] 2-butylpropanedioate (CID 101278843) is bis[2-(2-ethoxyethoxy)ethyl] 2-butylpropanedioate.
What is the SMILES notation for bis[2-(2-ethoxyethoxy)ethyl] 2-butylpropanedioate?
The canonical SMILES for bis[2-(2-ethoxyethoxy)ethyl] 2-butylpropanedioate is CCCCC(C(=O)OCCOCCOCC)C(=O)OCCOCCOCC.
What is the InChIKey of bis[2-(2-ethoxyethoxy)ethyl] 2-butylpropanedioate?
The InChIKey is CNJSCUQCPBCUMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H36O8/c1-4-7-8-17(18(20)26-15-13-24-11-9-22-5-2)19(21)27-16-14-25-12-10-23-6-3/h17H,4-16H2,1-3H3.
What are the key properties of bis[2-(2-ethoxyethoxy)ethyl] 2-butylpropanedioate?
bis[2-(2-ethoxyethoxy)ethyl] 2-butylpropanedioate has a molecular weight of 392.49 g/mol, XLogP of 1.99, 19 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis[2-(2-ethoxyethoxy)ethyl] 2-butylpropanedioate is sourced from PubChem (CID 101278843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).