About 5-[(Z)-2-methylsulfanylprop-1-enyl]-3,4-dihydro-2H-pyrrole
5-[(Z)-2-methylsulfanylprop-1-enyl]-3,4-dihydro-2H-pyrrole (PubChem CID 101281175) has the molecular formula C8H13NS
and a molecular weight of 155.27 g/mol. Its IUPAC name is 5-[(Z)-2-methylsulfanylprop-1-enyl]-3,4-dihydro-2H-pyrrole.
Molecular Properties
| Compound Name | 5-[(Z)-2-methylsulfanylprop-1-enyl]-3,4-dihydro-2H-pyrrole |
| PubChem CID | 101281175 |
| Molecular Formula | C8H13NS |
| Molecular Weight | 155.27 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | 5-[(Z)-2-methylsulfanylprop-1-enyl]-3,4-dihydro-2H-pyrrole |
| SMILES | CS/C(C)=C\C1=NCCC1 |
| InChI | InChI=1S/C8H13NS/c1-7(10-2)6-8-4-3-5-9-8/h6H,3-5H2,1-2H3/b7-6- |
| InChIKey | KXBFKDOTCGOHRJ-SREVYHEPSA-N |
| XLogP | 2.49 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.27 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[(Z)-2-methylsulfanylprop-1-enyl]-3,4-dihydro-2H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(Z)-2-methylsulfanylprop-1-enyl]-3,4-dihydro-2H-pyrrole?
The IUPAC name of 5-[(Z)-2-methylsulfanylprop-1-enyl]-3,4-dihydro-2H-pyrrole (CID 101281175) is 5-[(Z)-2-methylsulfanylprop-1-enyl]-3,4-dihydro-2H-pyrrole.
What is the SMILES notation for 5-[(Z)-2-methylsulfanylprop-1-enyl]-3,4-dihydro-2H-pyrrole?
The canonical SMILES for 5-[(Z)-2-methylsulfanylprop-1-enyl]-3,4-dihydro-2H-pyrrole is CS/C(C)=C\C1=NCCC1.
What is the InChIKey of 5-[(Z)-2-methylsulfanylprop-1-enyl]-3,4-dihydro-2H-pyrrole?
The InChIKey is KXBFKDOTCGOHRJ-SREVYHEPSA-N. The full InChI is InChI=1S/C8H13NS/c1-7(10-2)6-8-4-3-5-9-8/h6H,3-5H2,1-2H3/b7-6-.
What are the key properties of 5-[(Z)-2-methylsulfanylprop-1-enyl]-3,4-dihydro-2H-pyrrole?
5-[(Z)-2-methylsulfanylprop-1-enyl]-3,4-dihydro-2H-pyrrole has a molecular weight of 155.27 g/mol, XLogP of 2.49, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(Z)-2-methylsulfanylprop-1-enyl]-3,4-dihydro-2H-pyrrole is sourced from PubChem (CID 101281175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).