C23H44KNO4S — CID 101284647
potassium 4-[methyl-[(E)-octadec-9-enoyl]amino]butane-1-sulfonate (PubChem CID 101284647) has the molecular formula C23H44KNO4S and a molecular weight of 469.77 g/mol. Its IUPAC name is potassium 4-[methyl-[(E)-octadec-9-enoyl]amino]butane-1-sulfonate.
| Compound Name | potassium 4-[methyl-[(E)-octadec-9-enoyl]amino]butane-1-sulfonate |
|---|---|
| PubChem CID | 101284647 |
| Molecular Formula | C23H44KNO4S |
| Molecular Weight | 469.77 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | potassium 4-[methyl-[(E)-octadec-9-enoyl]amino]butane-1-sulfonate |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)N(C)CCCCS(=O)(=O)[O-].[K+] |
| InChI | InChI=1S/C23H45NO4S.K/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-23(25)24(2)21-18-19-22-29(26,27)28;/h10-11H,3-9,12-22H2,1-2H3,(H,26,27,28);/q;+1/p-1/b11-10+; |
| InChIKey | XDYQTRCIVDTEMV-ASTDGNLGSA-M |
| XLogP | 2.81 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.77 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|