C25H48KNO4S — CID 101283664
potassium 2-[[(E)-docos-11-enoyl]-methylamino]ethanesulfonate (PubChem CID 101283664) has the molecular formula C25H48KNO4S and a molecular weight of 497.83 g/mol. Its IUPAC name is potassium 2-[[(E)-docos-11-enoyl]-methylamino]ethanesulfonate.
| Compound Name | potassium 2-[[(E)-docos-11-enoyl]-methylamino]ethanesulfonate |
|---|---|
| PubChem CID | 101283664 |
| Molecular Formula | C25H48KNO4S |
| Molecular Weight | 497.83 g/mol |
| Exact Mass | 497.29 |
| IUPAC Name | potassium 2-[[(E)-docos-11-enoyl]-methylamino]ethanesulfonate |
| SMILES | CCCCCCCCCC/C=C/CCCCCCCCCC(=O)N(C)CCS(=O)(=O)[O-].[K+] |
| InChI | InChI=1S/C25H49NO4S.K/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-25(27)26(2)23-24-31(28,29)30;/h12-13H,3-11,14-24H2,1-2H3,(H,28,29,30);/q;+1/p-1/b13-12+; |
| InChIKey | YFSSUQVZKSYEEI-UEIGIMKUSA-M |
| XLogP | 3.59 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.83 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|