C15H28KNO4S — CID 101283598
potassium 2-[[(E)-dodec-2-enoyl]-methylamino]ethanesulfonate (PubChem CID 101283598) has the molecular formula C15H28KNO4S and a molecular weight of 357.56 g/mol. Its IUPAC name is potassium 2-[[(E)-dodec-2-enoyl]-methylamino]ethanesulfonate.
| Compound Name | potassium 2-[[(E)-dodec-2-enoyl]-methylamino]ethanesulfonate |
|---|---|
| PubChem CID | 101283598 |
| Molecular Formula | C15H28KNO4S |
| Molecular Weight | 357.56 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | potassium 2-[[(E)-dodec-2-enoyl]-methylamino]ethanesulfonate |
| SMILES | CCCCCCCCC/C=C/C(=O)N(C)CCS(=O)(=O)[O-].[K+] |
| InChI | InChI=1S/C15H29NO4S.K/c1-3-4-5-6-7-8-9-10-11-12-15(17)16(2)13-14-21(18,19)20;/h11-12H,3-10,13-14H2,1-2H3,(H,18,19,20);/q;+1/p-1/b12-11+; |
| InChIKey | ATAJCZCPRRVWGJ-CALJPSDSSA-M |
| XLogP | -0.31 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.56 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|