C34H64CaN2O8S2 — CID 101283914
calcium bis(3-[methyl-[(E)-tridec-2-enoyl]amino]propane-1-sulfonate) (PubChem CID 101283914) has the molecular formula C34H64CaN2O8S2 and a molecular weight of 733.10 g/mol. Its IUPAC name is calcium bis(3-[methyl-[(E)-tridec-2-enoyl]amino]propane-1-sulfonate).
| Compound Name | calcium bis(3-[methyl-[(E)-tridec-2-enoyl]amino]propane-1-sulfonate) |
|---|---|
| PubChem CID | 101283914 |
| Molecular Formula | C34H64CaN2O8S2 |
| Molecular Weight | 733.10 g/mol |
| Exact Mass | 732.37 |
| IUPAC Name | calcium bis(3-[methyl-[(E)-tridec-2-enoyl]amino]propane-1-sulfonate) |
| SMILES | CCCCCCCCCC/C=C/C(=O)N(C)CCCS(=O)(=O)[O-].CCCCCCCCCC/C=C/C(=O)N(C)CCCS(=O)(=O)[O-].[Ca+2] |
| InChI | InChI=1S/2C17H33NO4S.Ca/c2*1-3-4-5-6-7-8-9-10-11-12-14-17(19)18(2)15-13-16-23(20,21)22;/h2*12,14H,3-11,13,15-16H2,1-2H3,(H,20,21,22);/q;;+2/p-2/b2*14-12+; |
| InChIKey | XNSPVCZCNCDAMY-MRFGFUSTSA-L |
| XLogP | 6.55 |
| TPSA | 155.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.10 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|