C16H30NNaO4S — CID 101283600
sodium 2-[methyl-[(E)-tridec-2-enoyl]amino]ethanesulfonate (PubChem CID 101283600) has the molecular formula C16H30NNaO4S and a molecular weight of 355.48 g/mol. Its IUPAC name is sodium 2-[methyl-[(E)-tridec-2-enoyl]amino]ethanesulfonate.
| Compound Name | sodium 2-[methyl-[(E)-tridec-2-enoyl]amino]ethanesulfonate |
|---|---|
| PubChem CID | 101283600 |
| Molecular Formula | C16H30NNaO4S |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | sodium 2-[methyl-[(E)-tridec-2-enoyl]amino]ethanesulfonate |
| SMILES | CCCCCCCCCC/C=C/C(=O)N(C)CCS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C16H31NO4S.Na/c1-3-4-5-6-7-8-9-10-11-12-13-16(18)17(2)14-15-22(19,20)21;/h12-13H,3-11,14-15H2,1-2H3,(H,19,20,21);/q;+1/p-1/b13-12+; |
| InChIKey | WOMGMXRDNHITKE-UEIGIMKUSA-M |
| XLogP | 0.08 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|