C12H22KNO4S — CID 101284764
potassium 2-[[(E)-dec-1-enyl]sulfonylamino]acetate (PubChem CID 101284764) has the molecular formula C12H22KNO4S and a molecular weight of 315.48 g/mol. Its IUPAC name is potassium 2-[[(E)-dec-1-enyl]sulfonylamino]acetate.
| Compound Name | potassium 2-[[(E)-dec-1-enyl]sulfonylamino]acetate |
|---|---|
| PubChem CID | 101284764 |
| Molecular Formula | C12H22KNO4S |
| Molecular Weight | 315.48 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | potassium 2-[[(E)-dec-1-enyl]sulfonylamino]acetate |
| SMILES | CCCCCCCC/C=C/S(=O)(=O)NCC(=O)[O-].[K+] |
| InChI | InChI=1S/C12H23NO4S.K/c1-2-3-4-5-6-7-8-9-10-18(16,17)13-11-12(14)15;/h9-10,13H,2-8,11H2,1H3,(H,14,15);/q;+1/p-1/b10-9+; |
| InChIKey | SZQWYWXZVWELON-RRABGKBLSA-M |
| XLogP | -2.08 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.48 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|