C18H34O4 — CID 101288859
2-hydroxypropyl 11-(3-ethyloxiran-2-yl)undecanoate (PubChem CID 101288859) has the molecular formula C18H34O4 and a molecular weight of 314.47 g/mol. Its IUPAC name is 2-hydroxypropyl 11-(3-ethyloxiran-2-yl)undecanoate.
| Compound Name | 2-hydroxypropyl 11-(3-ethyloxiran-2-yl)undecanoate |
|---|---|
| PubChem CID | 101288859 |
| Molecular Formula | C18H34O4 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | 2-hydroxypropyl 11-(3-ethyloxiran-2-yl)undecanoate |
| SMILES | CCC1OC1CCCCCCCCCCC(=O)OCC(C)O |
| InChI | InChI=1S/C18H34O4/c1-3-16-17(22-16)12-10-8-6-4-5-7-9-11-13-18(20)21-14-15(2)19/h15-17,19H,3-14H2,1-2H3 |
| InChIKey | JPXIBHUGADYITM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|