C20H30O4 — CID 101289560
(1S,2R,5R,6R,8R,10S,13R,17S)-6-hydroxy-13-(hydroxymethyl)-1,6-dimethyl-11-oxapentacyclo[8.6.1.15,8.02,8.013,17]octadecan-12-one (PubChem CID 101289560) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is (1S,2R,5R,6R,8R,10S,13R,17S)-6-hydroxy-13-(hydroxymethyl)-1,6-dimethyl-11-oxapentacyclo[8.6.1.15,8.02,8.013,17]octadecan-12-one.
| Compound Name | (1S,2R,5R,6R,8R,10S,13R,17S)-6-hydroxy-13-(hydroxymethyl)-1,6-dimethyl-11-oxapentacyclo[8.6.1.15,8.02,8.013,17]octadecan-12-one |
|---|---|
| PubChem CID | 101289560 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (1S,2R,5R,6R,8R,10S,13R,17S)-6-hydroxy-13-(hydroxymethyl)-1,6-dimethyl-11-oxapentacyclo[8.6.1.15,8.02,8.013,17]octadecan-12-one |
| SMILES | C[C@]12CCC[C@@]3(CO)C(=O)O[C@@H](C[C@@]45C[C@@H](CC[C@H]41)[C@](C)(O)C5)[C@H]32 |
| InChI | InChI=1S/C20H30O4/c1-17-6-3-7-20(11-21)15(17)13(24-16(20)22)9-19-8-12(4-5-14(17)19)18(2,23)10-19/h12-15,21,23H,3-11H2,1-2H3/t12-,13+,14+,15+,17+,18-,19-,20+/m1/s1 |
| InChIKey | UKCPSJYAQHTFOC-IZFMTULVSA-N |
| XLogP | 2.66 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |