C19H26O5 — CID 163188416
(1R,2R,5R,6R,8R,9R,10S,11R)-6-hydroxy-6,11-dimethyl-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylic acid (PubChem CID 163188416) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is (1R,2R,5R,6R,8R,9R,10S,11R)-6-hydroxy-6,11-dimethyl-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylic acid.
| Compound Name | (1R,2R,5R,6R,8R,9R,10S,11R)-6-hydroxy-6,11-dimethyl-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylic acid |
|---|---|
| PubChem CID | 163188416 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | (1R,2R,5R,6R,8R,9R,10S,11R)-6-hydroxy-6,11-dimethyl-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylic acid |
| SMILES | C[C@]12CCC[C@@]3(OC1=O)[C@@H]1CC[C@@H]4C[C@]1(C[C@@]4(C)O)[C@H](C(=O)O)[C@H]32 |
| InChI | InChI=1S/C19H26O5/c1-16-6-3-7-19(24-15(16)22)11-5-4-10-8-18(11,9-17(10,2)23)12(13(16)19)14(20)21/h10-13,23H,3-9H2,1-2H3,(H,20,21)/t10-,11-,12+,13+,16-,17-,18-,19-/m1/s1 |
| InChIKey | WGVIRXSVGNPFAX-AHIGJZGOSA-N |
| XLogP | 2.36 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |