C20H26O5 — CID 162848967
(1R,2R,4R,7R,8S,9S,10S)-4-hydroxy-10-methyl-5-methylidene-11-oxo-12-oxapentacyclo[8.3.3.24,7.01,9.02,7]octadecane-8-carboxylic acid (PubChem CID 162848967) has the molecular formula C20H26O5 and a molecular weight of 346.42 g/mol. Its IUPAC name is (1R,2R,4R,7R,8S,9S,10S)-4-hydroxy-10-methyl-5-methylidene-11-oxo-12-oxapentacyclo[8.3.3.24,7.01,9.02,7]octadecane-8-carboxylic acid.
| Compound Name | (1R,2R,4R,7R,8S,9S,10S)-4-hydroxy-10-methyl-5-methylidene-11-oxo-12-oxapentacyclo[8.3.3.24,7.01,9.02,7]octadecane-8-carboxylic acid |
|---|---|
| PubChem CID | 162848967 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | (1R,2R,4R,7R,8S,9S,10S)-4-hydroxy-10-methyl-5-methylidene-11-oxo-12-oxapentacyclo[8.3.3.24,7.01,9.02,7]octadecane-8-carboxylic acid |
| SMILES | C=C1C[C@]23CC[C@@]1(O)C[C@H]2[C@@]12CCC[C@](C)(C(=O)OC1)[C@H]2[C@@H]3C(=O)O |
| InChI | InChI=1S/C20H26O5/c1-11-8-18-6-7-20(11,24)9-12(18)19-5-3-4-17(2,16(23)25-10-19)14(19)13(18)15(21)22/h12-14,24H,1,3-10H2,2H3,(H,21,22)/t12-,13-,14-,17+,18-,19-,20-/m1/s1 |
| InChIKey | AOCGDEBRRYMQKN-ZLIQWIABSA-N |
| XLogP | 2.53 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|