C19H25O6- — CID 46173150
(2R,5R,6R,8R,9S,10R,11S)-6-hydroxy-6-(hydroxymethyl)-11-methyl-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylate (PubChem CID 46173150) has the molecular formula C19H25O6- and a molecular weight of 349.40 g/mol. Its IUPAC name is (2R,5R,6R,8R,9S,10R,11S)-6-hydroxy-6-(hydroxymethyl)-11-methyl-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylate.
| Compound Name | (2R,5R,6R,8R,9S,10R,11S)-6-hydroxy-6-(hydroxymethyl)-11-methyl-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylate |
|---|---|
| PubChem CID | 46173150 |
| Molecular Formula | C19H25O6- |
| Molecular Weight | 349.40 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | (2R,5R,6R,8R,9S,10R,11S)-6-hydroxy-6-(hydroxymethyl)-11-methyl-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylate |
| SMILES | C[C@@]12CCCC3(OC1=O)[C@@H]1CC[C@@H]4C[C@]1(C[C@]4(O)CO)[C@@H](C(=O)[O-])[C@@H]32 |
| InChI | InChI=1S/C19H26O6/c1-16-5-2-6-19(25-15(16)23)11-4-3-10-7-17(11,8-18(10,24)9-20)12(13(16)19)14(21)22/h10-13,20,24H,2-9H2,1H3,(H,21,22)/p-1/t10-,11-,12-,13-,16+,17-,18+,19?/m1/s1 |
| InChIKey | OXEMPUBMLFVGQQ-XAGBHBTISA-M |
| XLogP | -0.00 |
| TPSA | 106.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.40 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |