C21H34O6 — CID 129008954
methyl (1R,2R,3S,4S,5R,9S,13R,14S)-2,3,14-trihydroxy-14-(hydroxymethyl)-5,9-dimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate (PubChem CID 129008954) has the molecular formula C21H34O6 and a molecular weight of 382.50 g/mol. Its IUPAC name is methyl (1R,2R,3S,4S,5R,9S,13R,14S)-2,3,14-trihydroxy-14-(hydroxymethyl)-5,9-dimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate.
| Compound Name | methyl (1R,2R,3S,4S,5R,9S,13R,14S)-2,3,14-trihydroxy-14-(hydroxymethyl)-5,9-dimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
|---|---|
| PubChem CID | 129008954 |
| Molecular Formula | C21H34O6 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | methyl (1R,2R,3S,4S,5R,9S,13R,14S)-2,3,14-trihydroxy-14-(hydroxymethyl)-5,9-dimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
| SMILES | COC(=O)[C@]1(C)CCC[C@@]2(C)C3CC[C@@H]4C[C@]3(C[C@@]4(O)CO)[C@@H](O)[C@@H](O)[C@H]12 |
| InChI | InChI=1S/C21H34O6/c1-18-7-4-8-19(2,17(25)27-3)15(18)14(23)16(24)20-9-12(5-6-13(18)20)21(26,10-20)11-22/h12-16,22-24,26H,4-11H2,1-3H3/t12-,13?,14+,15+,16+,18+,19-,20-,21-/m1/s1 |
| InChIKey | ZVRSDNQNDPDGHE-UVUKXLBVSA-N |
| XLogP | 1.24 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |