C15H20O5 — CID 101289897
(1-acetyloxy-3-tert-butyl-5-methyl-6-oxocyclohexa-2,4-dien-1-yl) acetate (PubChem CID 101289897) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is (1-acetyloxy-3-tert-butyl-5-methyl-6-oxocyclohexa-2,4-dien-1-yl) acetate.
| Compound Name | (1-acetyloxy-3-tert-butyl-5-methyl-6-oxocyclohexa-2,4-dien-1-yl) acetate |
|---|---|
| PubChem CID | 101289897 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | (1-acetyloxy-3-tert-butyl-5-methyl-6-oxocyclohexa-2,4-dien-1-yl) acetate |
| SMILES | CC(=O)OC1(OC(C)=O)C=C(C(C)(C)C)C=C(C)C1=O |
| InChI | InChI=1S/C15H20O5/c1-9-7-12(14(4,5)6)8-15(13(9)18,19-10(2)16)20-11(3)17/h7-8H,1-6H3 |
| InChIKey | BKTYZUPLCAZSGU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|