C14H20O4 — CID 101086410
(2-tert-butyl-1-methoxy-4-methyl-6-oxocyclohexa-2,4-dien-1-yl) acetate (PubChem CID 101086410) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is (2-tert-butyl-1-methoxy-4-methyl-6-oxocyclohexa-2,4-dien-1-yl) acetate.
| Compound Name | (2-tert-butyl-1-methoxy-4-methyl-6-oxocyclohexa-2,4-dien-1-yl) acetate |
|---|---|
| PubChem CID | 101086410 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | (2-tert-butyl-1-methoxy-4-methyl-6-oxocyclohexa-2,4-dien-1-yl) acetate |
| SMILES | COC1(OC(C)=O)C(=O)C=C(C)C=C1C(C)(C)C |
| InChI | InChI=1S/C14H20O4/c1-9-7-11(13(3,4)5)14(17-6,12(16)8-9)18-10(2)15/h7-8H,1-6H3 |
| InChIKey | NQQIKGLOCRHVQD-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|