C15H20O6 — CID 23270644
(1-acetyloxy-3-tert-butyl-5-methoxy-6-oxocyclohexa-2,4-dien-1-yl) acetate (PubChem CID 23270644) has the molecular formula C15H20O6 and a molecular weight of 296.32 g/mol. Its IUPAC name is (1-acetyloxy-3-tert-butyl-5-methoxy-6-oxocyclohexa-2,4-dien-1-yl) acetate.
| Compound Name | (1-acetyloxy-3-tert-butyl-5-methoxy-6-oxocyclohexa-2,4-dien-1-yl) acetate |
|---|---|
| PubChem CID | 23270644 |
| Molecular Formula | C15H20O6 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | (1-acetyloxy-3-tert-butyl-5-methoxy-6-oxocyclohexa-2,4-dien-1-yl) acetate |
| SMILES | COC1=CC(C(C)(C)C)=CC(OC(C)=O)(OC(C)=O)C1=O |
| InChI | InChI=1S/C15H20O6/c1-9(16)20-15(21-10(2)17)8-11(14(3,4)5)7-12(19-6)13(15)18/h7-8H,1-6H3 |
| InChIKey | FDTUEPUCWXHEFP-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|