C12H14O6 — CID 10658572
methyl 3-methoxy-4-oxo-3-propanoyloxycyclohexa-1,5-diene-1-carboxylate (PubChem CID 10658572) has the molecular formula C12H14O6 and a molecular weight of 254.24 g/mol. Its IUPAC name is methyl 3-methoxy-4-oxo-3-propanoyloxycyclohexa-1,5-diene-1-carboxylate.
| Compound Name | methyl 3-methoxy-4-oxo-3-propanoyloxycyclohexa-1,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 10658572 |
| Molecular Formula | C12H14O6 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | methyl 3-methoxy-4-oxo-3-propanoyloxycyclohexa-1,5-diene-1-carboxylate |
| SMILES | CCC(=O)OC1(OC)C=C(C(=O)OC)C=CC1=O |
| InChI | InChI=1S/C12H14O6/c1-4-10(14)18-12(17-3)7-8(11(15)16-2)5-6-9(12)13/h5-7H,4H2,1-3H3 |
| InChIKey | KQAJKHKEZFFKPH-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|