C12H8Br3N — CID 101290777
3,4-dibromo-N-(2-bromophenyl)aniline (PubChem CID 101290777) has the molecular formula C12H8Br3N and a molecular weight of 405.92 g/mol. Its IUPAC name is 3,4-dibromo-N-(2-bromophenyl)aniline.
| Compound Name | 3,4-dibromo-N-(2-bromophenyl)aniline |
|---|---|
| PubChem CID | 101290777 |
| Molecular Formula | C12H8Br3N |
| Molecular Weight | 405.92 g/mol |
| Exact Mass | 402.82 |
| IUPAC Name | 3,4-dibromo-N-(2-bromophenyl)aniline |
| SMILES | Brc1ccc(Nc2ccccc2Br)cc1Br |
| InChI | InChI=1S/C12H8Br3N/c13-9-6-5-8(7-11(9)15)16-12-4-2-1-3-10(12)14/h1-7,16H |
| InChIKey | XDSFIRHLNGLJEA-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.92 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |