C38H46CaO10S2 — CID 101292063
calcium;5-heptyl-2-hydroxy-4-phenoxybenzenesulfonic acid;5-heptyl-2-oxido-4-phenoxybenzenesulfonate (PubChem CID 101292063) has the molecular formula C38H46CaO10S2 and a molecular weight of 766.99 g/mol. Its IUPAC name is calcium;5-heptyl-2-hydroxy-4-phenoxybenzenesulfonic acid;5-heptyl-2-oxido-4-phenoxybenzenesulfonate.
| Compound Name | calcium;5-heptyl-2-hydroxy-4-phenoxybenzenesulfonic acid;5-heptyl-2-oxido-4-phenoxybenzenesulfonate |
|---|---|
| PubChem CID | 101292063 |
| Molecular Formula | C38H46CaO10S2 |
| Molecular Weight | 766.99 g/mol |
| Exact Mass | 766.22 |
| IUPAC Name | calcium;5-heptyl-2-hydroxy-4-phenoxybenzenesulfonic acid;5-heptyl-2-oxido-4-phenoxybenzenesulfonate |
| SMILES | CCCCCCCc1cc(S(=O)(=O)O)c(O)cc1Oc1ccccc1.CCCCCCCc1cc(S(=O)(=O)[O-])c([O-])cc1Oc1ccccc1.[Ca+2] |
| InChI | InChI=1S/2C19H24O5S.Ca/c2*1-2-3-4-5-7-10-15-13-19(25(21,22)23)17(20)14-18(15)24-16-11-8-6-9-12-16;/h2*6,8-9,11-14,20H,2-5,7,10H2,1H3,(H,21,22,23);/q;;+2/p-2 |
| InChIKey | TWHDTXFKWZTEEF-UHFFFAOYSA-L |
| XLogP | 8.53 |
| TPSA | 173.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.99 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|