C44H58CaO10S2 — CID 101295309
calcium;2-decyl-6-hydroxy-4-phenoxybenzenesulfonic acid;2-decyl-6-oxido-4-phenoxybenzenesulfonate (PubChem CID 101295309) has the molecular formula C44H58CaO10S2 and a molecular weight of 851.15 g/mol. Its IUPAC name is calcium;2-decyl-6-hydroxy-4-phenoxybenzenesulfonic acid;2-decyl-6-oxido-4-phenoxybenzenesulfonate.
| Compound Name | calcium;2-decyl-6-hydroxy-4-phenoxybenzenesulfonic acid;2-decyl-6-oxido-4-phenoxybenzenesulfonate |
|---|---|
| PubChem CID | 101295309 |
| Molecular Formula | C44H58CaO10S2 |
| Molecular Weight | 851.15 g/mol |
| Exact Mass | 850.31 |
| IUPAC Name | calcium;2-decyl-6-hydroxy-4-phenoxybenzenesulfonic acid;2-decyl-6-oxido-4-phenoxybenzenesulfonate |
| SMILES | CCCCCCCCCCc1cc(Oc2ccccc2)cc(O)c1S(=O)(=O)O.CCCCCCCCCCc1cc(Oc2ccccc2)cc([O-])c1S(=O)(=O)[O-].[Ca+2] |
| InChI | InChI=1S/2C22H30O5S.Ca/c2*1-2-3-4-5-6-7-8-10-13-18-16-20(27-19-14-11-9-12-15-19)17-21(23)22(18)28(24,25)26;/h2*9,11-12,14-17,23H,2-8,10,13H2,1H3,(H,24,25,26);/q;;+2/p-2 |
| InChIKey | NEEATWIUDDJFRT-UHFFFAOYSA-L |
| XLogP | 10.87 |
| TPSA | 173.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.15 |
| LogP ≤ 5 | 10.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|