About 5-butyl-2,3-dinitrophenol
5-butyl-2,3-dinitrophenol (PubChem CID 101292284) has the molecular formula C10H12N2O5
and a molecular weight of 240.21 g/mol. Its IUPAC name is 5-butyl-2,3-dinitrophenol.
Molecular Properties
| Compound Name | 5-butyl-2,3-dinitrophenol |
| PubChem CID | 101292284 |
| Molecular Formula | C10H12N2O5 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 5-butyl-2,3-dinitrophenol |
| SMILES | CCCCc1cc(O)c([N+](=O)[O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H12N2O5/c1-2-3-4-7-5-8(11(14)15)10(12(16)17)9(13)6-7/h5-6,13H,2-4H2,1H3 |
| InChIKey | BZWCMKORECAPNU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-butyl-2,3-dinitrophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butyl-2,3-dinitrophenol?
The IUPAC name of 5-butyl-2,3-dinitrophenol (CID 101292284) is 5-butyl-2,3-dinitrophenol.
What is the SMILES notation for 5-butyl-2,3-dinitrophenol?
The canonical SMILES for 5-butyl-2,3-dinitrophenol is CCCCc1cc(O)c([N+](=O)[O-])c([N+](=O)[O-])c1.
What is the InChIKey of 5-butyl-2,3-dinitrophenol?
The InChIKey is BZWCMKORECAPNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O5/c1-2-3-4-7-5-8(11(14)15)10(12(16)17)9(13)6-7/h5-6,13H,2-4H2,1H3.
What are the key properties of 5-butyl-2,3-dinitrophenol?
5-butyl-2,3-dinitrophenol has a molecular weight of 240.21 g/mol, XLogP of 2.55, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butyl-2,3-dinitrophenol is sourced from PubChem (CID 101292284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).