About 2,4-dibutyl-1-nitrobenzene
2,4-dibutyl-1-nitrobenzene (PubChem CID 11207075) has the molecular formula C14H21NO2
and a molecular weight of 235.33 g/mol. Its IUPAC name is 2,4-dibutyl-1-nitrobenzene.
Molecular Properties
| Compound Name | 2,4-dibutyl-1-nitrobenzene |
| PubChem CID | 11207075 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 2,4-dibutyl-1-nitrobenzene |
| SMILES | CCCCc1ccc([N+](=O)[O-])c(CCCC)c1 |
| InChI | InChI=1S/C14H21NO2/c1-3-5-7-12-9-10-14(15(16)17)13(11-12)8-6-4-2/h9-11H,3-8H2,1-2H3 |
| InChIKey | GMYDZEQSSXLBCL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dibutyl-1-nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dibutyl-1-nitrobenzene?
The IUPAC name of 2,4-dibutyl-1-nitrobenzene (CID 11207075) is 2,4-dibutyl-1-nitrobenzene.
What is the SMILES notation for 2,4-dibutyl-1-nitrobenzene?
The canonical SMILES for 2,4-dibutyl-1-nitrobenzene is CCCCc1ccc([N+](=O)[O-])c(CCCC)c1.
What is the InChIKey of 2,4-dibutyl-1-nitrobenzene?
The InChIKey is GMYDZEQSSXLBCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO2/c1-3-5-7-12-9-10-14(15(16)17)13(11-12)8-6-4-2/h9-11H,3-8H2,1-2H3.
What are the key properties of 2,4-dibutyl-1-nitrobenzene?
2,4-dibutyl-1-nitrobenzene has a molecular weight of 235.33 g/mol, XLogP of 4.28, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dibutyl-1-nitrobenzene is sourced from PubChem (CID 11207075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).