C15H24O — CID 101297706
(4Z,8Z)-2,6,6,9-tetramethylcycloundeca-4,8-dien-1-one (PubChem CID 101297706) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is (4Z,8Z)-2,6,6,9-tetramethylcycloundeca-4,8-dien-1-one.
| Compound Name | (4Z,8Z)-2,6,6,9-tetramethylcycloundeca-4,8-dien-1-one |
|---|---|
| PubChem CID | 101297706 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | (4Z,8Z)-2,6,6,9-tetramethylcycloundeca-4,8-dien-1-one |
| SMILES | C/C1=C/CC(C)(C)/C=C\CC(C)C(=O)CC1 |
| InChI | InChI=1S/C15H24O/c1-12-7-8-14(16)13(2)6-5-10-15(3,4)11-9-12/h5,9-10,13H,6-8,11H2,1-4H3/b10-5-,12-9- |
| InChIKey | XWFINABYEHNSEP-CGBKSYCJSA-N |
| XLogP | 4.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|