About 4-cyclohexylhept-6-enal
4-cyclohexylhept-6-enal (PubChem CID 101297899) has the molecular formula C13H22O
and a molecular weight of 194.32 g/mol. Its IUPAC name is 4-cyclohexylhept-6-enal.
Molecular Properties
| Compound Name | 4-cyclohexylhept-6-enal |
| PubChem CID | 101297899 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | 4-cyclohexylhept-6-enal |
| SMILES | C=CCC(CCC=O)C1CCCCC1 |
| InChI | InChI=1S/C13H22O/c1-2-7-12(10-6-11-14)13-8-4-3-5-9-13/h2,11-13H,1,3-10H2 |
| InChIKey | MJZWCRYFWPFVQB-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclohexylhept-6-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexylhept-6-enal?
The IUPAC name of 4-cyclohexylhept-6-enal (CID 101297899) is 4-cyclohexylhept-6-enal.
What is the SMILES notation for 4-cyclohexylhept-6-enal?
The canonical SMILES for 4-cyclohexylhept-6-enal is C=CCC(CCC=O)C1CCCCC1.
What is the InChIKey of 4-cyclohexylhept-6-enal?
The InChIKey is MJZWCRYFWPFVQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O/c1-2-7-12(10-6-11-14)13-8-4-3-5-9-13/h2,11-13H,1,3-10H2.
What are the key properties of 4-cyclohexylhept-6-enal?
4-cyclohexylhept-6-enal has a molecular weight of 194.32 g/mol, XLogP of 3.74, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexylhept-6-enal is sourced from PubChem (CID 101297899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).