C29H46O2 — CID 101306867
(4S,5S,10S,13R,14R,17R)-17-[(1S)-1-(5,5-dimethyloxolan-2-yl)ethyl]-4,10,13,14-tetramethyl-2,4,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 101306867) has the molecular formula C29H46O2 and a molecular weight of 426.69 g/mol. Its IUPAC name is (4S,5S,10S,13R,14R,17R)-17-[(1S)-1-(5,5-dimethyloxolan-2-yl)ethyl]-4,10,13,14-tetramethyl-2,4,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (4S,5S,10S,13R,14R,17R)-17-[(1S)-1-(5,5-dimethyloxolan-2-yl)ethyl]-4,10,13,14-tetramethyl-2,4,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 101306867 |
| Molecular Formula | C29H46O2 |
| Molecular Weight | 426.69 g/mol |
| Exact Mass | 426.35 |
| IUPAC Name | (4S,5S,10S,13R,14R,17R)-17-[(1S)-1-(5,5-dimethyloxolan-2-yl)ethyl]-4,10,13,14-tetramethyl-2,4,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@@H]1C(=O)CC[C@]2(C)C3=C(CC[C@@H]12)[C@]1(C)CC[C@H]([C@H](C)C2CCC(C)(C)O2)[C@@]1(C)CC3 |
| InChI | InChI=1S/C29H46O2/c1-18-20-8-9-23-22(27(20,5)15-12-24(18)30)11-17-28(6)21(10-16-29(23,28)7)19(2)25-13-14-26(3,4)31-25/h18-21,25H,8-17H2,1-7H3/t18-,19-,20-,21+,25?,27-,28+,29-/m0/s1 |
| InChIKey | JECACBMOJQISKJ-BWPRGTHOSA-N |
| XLogP | 7.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.69 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|