C44H74O7S — CID 101308840
2,3-bis[[(E)-octadec-10-enoxy]carbonyl]benzenesulfonic acid (PubChem CID 101308840) has the molecular formula C44H74O7S and a molecular weight of 747.14 g/mol. Its IUPAC name is 2,3-bis[[(E)-octadec-10-enoxy]carbonyl]benzenesulfonic acid.
| Compound Name | 2,3-bis[[(E)-octadec-10-enoxy]carbonyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 101308840 |
| Molecular Formula | C44H74O7S |
| Molecular Weight | 747.14 g/mol |
| Exact Mass | 746.52 |
| IUPAC Name | 2,3-bis[[(E)-octadec-10-enoxy]carbonyl]benzenesulfonic acid |
| SMILES | CCCCCCC/C=C/CCCCCCCCCOC(=O)c1cccc(S(=O)(=O)O)c1C(=O)OCCCCCCCCC/C=C/CCCCCCC |
| InChI | InChI=1S/C44H74O7S/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-38-50-43(45)40-36-35-37-41(52(47,48)49)42(40)44(46)51-39-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h15-18,35-37H,3-14,19-34,38-39H2,1-2H3,(H,47,48,49)/b17-15+,18-16+ |
| InChIKey | RVFVVJLTKPUOCV-YTEMWHBBSA-N |
| XLogP | 13.32 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.14 |
| LogP ≤ 5 | 13.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|