C46H78O7S — CID 101308976
2,3-bis[[(E)-nonadec-10-enoxy]carbonyl]benzenesulfonic acid (PubChem CID 101308976) has the molecular formula C46H78O7S and a molecular weight of 775.19 g/mol. Its IUPAC name is 2,3-bis[[(E)-nonadec-10-enoxy]carbonyl]benzenesulfonic acid.
| Compound Name | 2,3-bis[[(E)-nonadec-10-enoxy]carbonyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 101308976 |
| Molecular Formula | C46H78O7S |
| Molecular Weight | 775.19 g/mol |
| Exact Mass | 774.55 |
| IUPAC Name | 2,3-bis[[(E)-nonadec-10-enoxy]carbonyl]benzenesulfonic acid |
| SMILES | CCCCCCCC/C=C/CCCCCCCCCOC(=O)c1cccc(S(=O)(=O)O)c1C(=O)OCCCCCCCCC/C=C/CCCCCCCC |
| InChI | InChI=1S/C46H78O7S/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-40-52-45(47)42-38-37-39-43(54(49,50)51)44(42)46(48)53-41-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,37-39H,3-16,21-36,40-41H2,1-2H3,(H,49,50,51)/b19-17+,20-18+ |
| InChIKey | BTVGAOBHHSLBAI-XPWSMXQVSA-N |
| XLogP | 14.10 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.19 |
| LogP ≤ 5 | 14.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|