C88H146CaO14S2 — CID 101308931
calcium bis(2,3-bis[[(E)-octadec-9-enoxy]carbonyl]benzenesulfonate) (PubChem CID 101308931) has the molecular formula C88H146CaO14S2 and a molecular weight of 1532.33 g/mol. Its IUPAC name is calcium bis(2,3-bis[[(E)-octadec-9-enoxy]carbonyl]benzenesulfonate).
| Compound Name | calcium bis(2,3-bis[[(E)-octadec-9-enoxy]carbonyl]benzenesulfonate) |
|---|---|
| PubChem CID | 101308931 |
| Molecular Formula | C88H146CaO14S2 |
| Molecular Weight | 1532.33 g/mol |
| Exact Mass | 1530.98 |
| IUPAC Name | calcium bis(2,3-bis[[(E)-octadec-9-enoxy]carbonyl]benzenesulfonate) |
| SMILES | CCCCCCCC/C=C/CCCCCCCCOC(=O)c1cccc(S(=O)(=O)[O-])c1C(=O)OCCCCCCCC/C=C/CCCCCCCC.CCCCCCCC/C=C/CCCCCCCCOC(=O)c1cccc(S(=O)(=O)[O-])c1C(=O)OCCCCCCCC/C=C/CCCCCCCC.[Ca+2] |
| InChI | InChI=1S/2C44H74O7S.Ca/c2*1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-38-50-43(45)40-36-35-37-41(52(47,48)49)42(40)44(46)51-39-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2;/h2*17-20,35-37H,3-16,21-34,38-39H2,1-2H3,(H,47,48,49);/q;;+2/p-2/b2*19-17+,20-18+; |
| InChIKey | CTDBODWBAAGIFR-SYTWWBQDSA-L |
| XLogP | 25.58 |
| TPSA | 219.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 70 |
| Heavy Atoms | 105 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1532.33 |
| LogP ≤ 5 | 25.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|