C96H162CaO14S2 — CID 101309223
calcium bis(2,3-bis[[(E)-icos-9-enoxy]carbonyl]benzenesulfonate) (PubChem CID 101309223) has the molecular formula C96H162CaO14S2 and a molecular weight of 1644.55 g/mol. Its IUPAC name is calcium bis(2,3-bis[[(E)-icos-9-enoxy]carbonyl]benzenesulfonate).
| Compound Name | calcium bis(2,3-bis[[(E)-icos-9-enoxy]carbonyl]benzenesulfonate) |
|---|---|
| PubChem CID | 101309223 |
| Molecular Formula | C96H162CaO14S2 |
| Molecular Weight | 1644.55 g/mol |
| Exact Mass | 1643.10 |
| IUPAC Name | calcium bis(2,3-bis[[(E)-icos-9-enoxy]carbonyl]benzenesulfonate) |
| SMILES | CCCCCCCCCC/C=C/CCCCCCCCOC(=O)c1cccc(S(=O)(=O)[O-])c1C(=O)OCCCCCCCC/C=C/CCCCCCCCCC.CCCCCCCCCC/C=C/CCCCCCCCOC(=O)c1cccc(S(=O)(=O)[O-])c1C(=O)OCCCCCCCC/C=C/CCCCCCCCCC.[Ca+2] |
| InChI | InChI=1S/2C48H82O7S.Ca/c2*1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-42-54-47(49)44-40-39-41-45(56(51,52)53)46(44)48(50)55-43-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2;/h2*21-24,39-41H,3-20,25-38,42-43H2,1-2H3,(H,51,52,53);/q;;+2/p-2/b2*23-21+,24-22+; |
| InChIKey | HMTHWXHPLRNADB-AFIAZZQBSA-L |
| XLogP | 28.70 |
| TPSA | 219.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 78 |
| Heavy Atoms | 113 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1644.55 |
| LogP ≤ 5 | 28.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|