C40H65KO7S — CID 101308638
potassium 2,3-bis[[(E)-hexadec-6-enoxy]carbonyl]benzenesulfonate (PubChem CID 101308638) has the molecular formula C40H65KO7S and a molecular weight of 729.12 g/mol. Its IUPAC name is potassium 2,3-bis[[(E)-hexadec-6-enoxy]carbonyl]benzenesulfonate.
| Compound Name | potassium 2,3-bis[[(E)-hexadec-6-enoxy]carbonyl]benzenesulfonate |
|---|---|
| PubChem CID | 101308638 |
| Molecular Formula | C40H65KO7S |
| Molecular Weight | 729.12 g/mol |
| Exact Mass | 728.41 |
| IUPAC Name | potassium 2,3-bis[[(E)-hexadec-6-enoxy]carbonyl]benzenesulfonate |
| SMILES | CCCCCCCCC/C=C/CCCCCOC(=O)c1cccc(S(=O)(=O)[O-])c1C(=O)OCCCCC/C=C/CCCCCCCCC.[K+] |
| InChI | InChI=1S/C40H66O7S.K/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-34-46-39(41)36-32-31-33-37(48(43,44)45)38(36)40(42)47-35-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2;/h19-22,31-33H,3-18,23-30,34-35H2,1-2H3,(H,43,44,45);/q;+1/p-1/b21-19+,22-20+; |
| InChIKey | GKOKLFKLCUEXGV-ULQNKYRSSA-M |
| XLogP | 8.42 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.12 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|