About 2,7-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline
2,7-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline (PubChem CID 10130931) has the molecular formula C17H19N
and a molecular weight of 237.35 g/mol. Its IUPAC name is 2,7-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline.
Molecular Properties
| Compound Name | 2,7-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline |
| PubChem CID | 10130931 |
| Molecular Formula | C17H19N |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 2,7-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline |
| SMILES | Cc1ccc2c(c1)CN(C)CC2c1ccccc1 |
| InChI | InChI=1S/C17H19N/c1-13-8-9-16-15(10-13)11-18(2)12-17(16)14-6-4-3-5-7-14/h3-10,17H,11-12H2,1-2H3 |
| InChIKey | HEKXQZYFIMYCKA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,7-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline?
The IUPAC name of 2,7-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline (CID 10130931) is 2,7-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline.
What is the SMILES notation for 2,7-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline?
The canonical SMILES for 2,7-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline is Cc1ccc2c(c1)CN(C)CC2c1ccccc1.
What is the InChIKey of 2,7-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline?
The InChIKey is HEKXQZYFIMYCKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N/c1-13-8-9-16-15(10-13)11-18(2)12-17(16)14-6-4-3-5-7-14/h3-10,17H,11-12H2,1-2H3.
What are the key properties of 2,7-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline?
2,7-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline has a molecular weight of 237.35 g/mol, XLogP of 3.57, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline is sourced from PubChem (CID 10130931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).