C56H86O6PbS2 — CID 101310039
bis(3,5-di(nonyl)naphthalene-1-sulfonate);lead(2+) (PubChem CID 101310039) has the molecular formula C56H86O6PbS2 and a molecular weight of 1126.63 g/mol. Its IUPAC name is bis(3,5-di(nonyl)naphthalene-1-sulfonate);lead(2+).
| Compound Name | bis(3,5-di(nonyl)naphthalene-1-sulfonate);lead(2+) |
|---|---|
| PubChem CID | 101310039 |
| Molecular Formula | C56H86O6PbS2 |
| Molecular Weight | 1126.63 g/mol |
| Exact Mass | 1126.56 |
| IUPAC Name | bis(3,5-di(nonyl)naphthalene-1-sulfonate);lead(2+) |
| SMILES | CCCCCCCCCc1cc(S(=O)(=O)[O-])c2cccc(CCCCCCCCC)c2c1.CCCCCCCCCc1cc(S(=O)(=O)[O-])c2cccc(CCCCCCCCC)c2c1.[Pb+2] |
| InChI | InChI=1S/2C28H44O3S.Pb/c2*1-3-5-7-9-11-13-15-18-24-22-27-25(19-16-14-12-10-8-6-4-2)20-17-21-26(27)28(23-24)32(29,30)31;/h2*17,20-23H,3-16,18-19H2,1-2H3,(H,29,30,31);/q;;+2/p-2 |
| InChIKey | VAQHBDFVMFUPRH-UHFFFAOYSA-L |
| XLogP | 16.28 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1126.63 |
| LogP ≤ 5 | 16.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|