C28H38CaO6 — CID 101311097
calcium;2-heptyl-3-hydroxybenzoic acid;2-heptyl-3-oxidobenzoate (PubChem CID 101311097) has the molecular formula C28H38CaO6 and a molecular weight of 510.68 g/mol. Its IUPAC name is calcium;2-heptyl-3-hydroxybenzoic acid;2-heptyl-3-oxidobenzoate.
| Compound Name | calcium;2-heptyl-3-hydroxybenzoic acid;2-heptyl-3-oxidobenzoate |
|---|---|
| PubChem CID | 101311097 |
| Molecular Formula | C28H38CaO6 |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | calcium;2-heptyl-3-hydroxybenzoic acid;2-heptyl-3-oxidobenzoate |
| SMILES | CCCCCCCc1c(O)cccc1C(=O)O.CCCCCCCc1c([O-])cccc1C(=O)[O-].[Ca+2] |
| InChI | InChI=1S/2C14H20O3.Ca/c2*1-2-3-4-5-6-8-11-12(14(16)17)9-7-10-13(11)15;/h2*7,9-10,15H,2-6,8H2,1H3,(H,16,17);/q;;+2/p-2 |
| InChIKey | XNZHEQWOYJSXFW-UHFFFAOYSA-L |
| XLogP | 4.86 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|