About calcium;2-hydroxy-3-nonylbenzoic acid;3-nonyl-2-oxidobenzoate
calcium;2-hydroxy-3-nonylbenzoic acid;3-nonyl-2-oxidobenzoate (PubChem CID 101311166) has the molecular formula C32H46CaO6
and a molecular weight of 566.79 g/mol. Its IUPAC name is calcium;2-hydroxy-3-nonylbenzoic acid;3-nonyl-2-oxidobenzoate.
Molecular Properties
| Compound Name | calcium;2-hydroxy-3-nonylbenzoic acid;3-nonyl-2-oxidobenzoate |
| PubChem CID | 101311166 |
| Molecular Formula | C32H46CaO6 |
| Molecular Weight | 566.79 g/mol |
| Exact Mass | 566.29 |
| IUPAC Name | calcium;2-hydroxy-3-nonylbenzoic acid;3-nonyl-2-oxidobenzoate |
| SMILES | CCCCCCCCCc1cccc(C(=O)O)c1O.CCCCCCCCCc1cccc(C(=O)[O-])c1[O-].[Ca+2] |
| InChI | InChI=1S/2C16H24O3.Ca/c2*1-2-3-4-5-6-7-8-10-13-11-9-12-14(15(13)17)16(18)19;/h2*9,11-12,17H,2-8,10H2,1H3,(H,18,19);/q;;+2/p-2 |
| InChIKey | VZEQVGLXLILHBV-UHFFFAOYSA-L |
| XLogP | 6.42 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 566.79 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze calcium;2-hydroxy-3-nonylbenzoic acid;3-nonyl-2-oxidobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;2-hydroxy-3-nonylbenzoic acid;3-nonyl-2-oxidobenzoate?
The IUPAC name of calcium;2-hydroxy-3-nonylbenzoic acid;3-nonyl-2-oxidobenzoate (CID 101311166) is calcium;2-hydroxy-3-nonylbenzoic acid;3-nonyl-2-oxidobenzoate.
What is the SMILES notation for calcium;2-hydroxy-3-nonylbenzoic acid;3-nonyl-2-oxidobenzoate?
The canonical SMILES for calcium;2-hydroxy-3-nonylbenzoic acid;3-nonyl-2-oxidobenzoate is CCCCCCCCCc1cccc(C(=O)O)c1O.CCCCCCCCCc1cccc(C(=O)[O-])c1[O-].[Ca+2].
What is the InChIKey of calcium;2-hydroxy-3-nonylbenzoic acid;3-nonyl-2-oxidobenzoate?
The InChIKey is VZEQVGLXLILHBV-UHFFFAOYSA-L. The full InChI is InChI=1S/2C16H24O3.Ca/c2*1-2-3-4-5-6-7-8-10-13-11-9-12-14(15(13)17)16(18)19;/h2*9,11-12,17H,2-8,10H2,1H3,(H,18,19);/q;;+2/p-2.
What are the key properties of calcium;2-hydroxy-3-nonylbenzoic acid;3-nonyl-2-oxidobenzoate?
calcium;2-hydroxy-3-nonylbenzoic acid;3-nonyl-2-oxidobenzoate has a molecular weight of 566.79 g/mol, XLogP of 6.42, 18 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;2-hydroxy-3-nonylbenzoic acid;3-nonyl-2-oxidobenzoate is sourced from PubChem (CID 101311166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).