C17H24O2 — CID 101312519
2-[[3-[(E)-hept-3-enyl]phenoxy]methyl]-2-methyloxirane (PubChem CID 101312519) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is 2-[[3-[(E)-hept-3-enyl]phenoxy]methyl]-2-methyloxirane.
| Compound Name | 2-[[3-[(E)-hept-3-enyl]phenoxy]methyl]-2-methyloxirane |
|---|---|
| PubChem CID | 101312519 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | 2-[[3-[(E)-hept-3-enyl]phenoxy]methyl]-2-methyloxirane |
| SMILES | CCC/C=C/CCc1cccc(OCC2(C)CO2)c1 |
| InChI | InChI=1S/C17H24O2/c1-3-4-5-6-7-9-15-10-8-11-16(12-15)18-13-17(2)14-19-17/h5-6,8,10-12H,3-4,7,9,13-14H2,1-2H3/b6-5+ |
| InChIKey | RHEGRKXYUJYARR-AATRIKPKSA-N |
| XLogP | 4.14 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|