C23H36O2 — CID 101312852
2-methyl-2-[[3-[(E)-tridec-6-enyl]phenoxy]methyl]oxirane (PubChem CID 101312852) has the molecular formula C23H36O2 and a molecular weight of 344.54 g/mol. Its IUPAC name is 2-methyl-2-[[3-[(E)-tridec-6-enyl]phenoxy]methyl]oxirane.
| Compound Name | 2-methyl-2-[[3-[(E)-tridec-6-enyl]phenoxy]methyl]oxirane |
|---|---|
| PubChem CID | 101312852 |
| Molecular Formula | C23H36O2 |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | 2-methyl-2-[[3-[(E)-tridec-6-enyl]phenoxy]methyl]oxirane |
| SMILES | CCCCCC/C=C/CCCCCc1cccc(OCC2(C)CO2)c1 |
| InChI | InChI=1S/C23H36O2/c1-3-4-5-6-7-8-9-10-11-12-13-15-21-16-14-17-22(18-21)24-19-23(2)20-25-23/h8-9,14,16-18H,3-7,10-13,15,19-20H2,1-2H3/b9-8+ |
| InChIKey | CBNUAOJUGFHOOJ-CMDGGOBGSA-N |
| XLogP | 6.48 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|