C26H13F29N2O2 — CID 101316102
3-isocyanato-2-methyl-N-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,17-nonacosafluoroheptadecan-2-yl)benzamide (PubChem CID 101316102) has the molecular formula C26H13F29N2O2 and a molecular weight of 936.34 g/mol. Its IUPAC name is 3-isocyanato-2-methyl-N-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,17-nonacosafluoroheptadecan-2-yl)benzamide.
| Compound Name | 3-isocyanato-2-methyl-N-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,17-nonacosafluoroheptadecan-2-yl)benzamide |
|---|---|
| PubChem CID | 101316102 |
| Molecular Formula | C26H13F29N2O2 |
| Molecular Weight | 936.34 g/mol |
| Exact Mass | 936.05 |
| IUPAC Name | 3-isocyanato-2-methyl-N-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,17-nonacosafluoroheptadecan-2-yl)benzamide |
| SMILES | Cc1c(N=C=O)cccc1C(=O)NC(C)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C26H13F29N2O2/c1-8(57-12(59)10-4-3-5-11(9(10)2)56-7-58)6-13(27,28)14(29,30)15(31,32)16(33,34)17(35,36)18(37,38)19(39,40)20(41,42)21(43,44)22(45,46)23(47,48)24(49,50)25(51,52)26(53,54)55/h3-5,8H,6H2,1-2H3,(H,57,59) |
| InChIKey | XIIYIPJBFYSOLE-UHFFFAOYSA-N |
| XLogP | 11.29 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 936.34 |
| LogP ≤ 5 | 11.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|